C19H15F3N2O2 — CID 87148607
2,2,7-trifluoro-4-prop-2-ynyl-6-(4,5,6,7-tetrahydroisoindol-2-yl)-1,4-benzoxazin-3-one (PubChem CID 87148607) has the molecular formula C19H15F3N2O2 and a molecular weight of 360.34 g/mol. Its IUPAC name is 2,2,7-trifluoro-4-prop-2-ynyl-6-(4,5,6,7-tetrahydroisoindol-2-yl)-1,4-benzoxazin-3-one.
| Compound Name | 2,2,7-trifluoro-4-prop-2-ynyl-6-(4,5,6,7-tetrahydroisoindol-2-yl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 87148607 |
| Molecular Formula | C19H15F3N2O2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2,2,7-trifluoro-4-prop-2-ynyl-6-(4,5,6,7-tetrahydroisoindol-2-yl)-1,4-benzoxazin-3-one |
| SMILES | C#CCN1C(=O)C(F)(F)Oc2cc(F)c(-n3cc4c(c3)CCCC4)cc21 |
| InChI | InChI=1S/C19H15F3N2O2/c1-2-7-24-16-9-15(23-10-12-5-3-4-6-13(12)11-23)14(20)8-17(16)26-19(21,22)18(24)25/h1,8-11H,3-7H2 |
| InChIKey | BCGHANZQRTYLFR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|