C44H36N4O8 — CID 87149627
2-O-(2-cyanophenyl) 1-O-[[(2R,3S,5S)-3-hydroxy-5-[4-(methoxyamino)-2-oxopyrimidin-1-yl]-5-trityloxolan-2-yl]methyl] benzene-1,2-dicarboxylate (PubChem CID 87149627) has the molecular formula C44H36N4O8 and a molecular weight of 748.79 g/mol. Its IUPAC name is 2-O-(2-cyanophenyl) 1-O-[[(2R,3S,5S)-3-hydroxy-5-[4-(methoxyamino)-2-oxopyrimidin-1-yl]-5-trityloxolan-2-yl]methyl] benzene-1,2-dicarboxylate.
| Compound Name | 2-O-(2-cyanophenyl) 1-O-[[(2R,3S,5S)-3-hydroxy-5-[4-(methoxyamino)-2-oxopyrimidin-1-yl]-5-trityloxolan-2-yl]methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 87149627 |
| Molecular Formula | C44H36N4O8 |
| Molecular Weight | 748.79 g/mol |
| Exact Mass | 748.25 |
| IUPAC Name | 2-O-(2-cyanophenyl) 1-O-[[(2R,3S,5S)-3-hydroxy-5-[4-(methoxyamino)-2-oxopyrimidin-1-yl]-5-trityloxolan-2-yl]methyl] benzene-1,2-dicarboxylate |
| SMILES | CONc1ccn([C@@]2(C(c3ccccc3)(c3ccccc3)c3ccccc3)C[C@H](O)[C@@H](COC(=O)c3ccccc3C(=O)Oc3ccccc3C#N)O2)c(=O)n1 |
| InChI | InChI=1S/C44H36N4O8/c1-53-47-39-25-26-48(42(52)46-39)43(44(31-16-5-2-6-17-31,32-18-7-3-8-19-32)33-20-9-4-10-21-33)27-36(49)38(56-43)29-54-40(50)34-22-12-13-23-35(34)41(51)55-37-24-14-11-15-30(37)28-45/h2-26,36,38,49H,27,29H2,1H3,(H,46,47,52)/t36-,38+,43-/m0/s1 |
| InChIKey | ZHZMNUDXOBAPMF-ZCFPKRHHSA-N |
| XLogP | 6.00 |
| TPSA | 162.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.79 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|