C17H20Cl2N2O4 — CID 87149779
methyl (2S)-2-[4-(3,4-dichlorophenyl)-3-methyl-7-oxo-1,4-diazepan-1-yl]-4-oxobutanoate (PubChem CID 87149779) has the molecular formula C17H20Cl2N2O4 and a molecular weight of 387.26 g/mol. Its IUPAC name is methyl (2S)-2-[4-(3,4-dichlorophenyl)-3-methyl-7-oxo-1,4-diazepan-1-yl]-4-oxobutanoate.
| Compound Name | methyl (2S)-2-[4-(3,4-dichlorophenyl)-3-methyl-7-oxo-1,4-diazepan-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 87149779 |
| Molecular Formula | C17H20Cl2N2O4 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | methyl (2S)-2-[4-(3,4-dichlorophenyl)-3-methyl-7-oxo-1,4-diazepan-1-yl]-4-oxobutanoate |
| SMILES | COC(=O)[C@H](CC=O)N1CC(C)N(c2ccc(Cl)c(Cl)c2)CCC1=O |
| InChI | InChI=1S/C17H20Cl2N2O4/c1-11-10-21(15(6-8-22)17(24)25-2)16(23)5-7-20(11)12-3-4-13(18)14(19)9-12/h3-4,8-9,11,15H,5-7,10H2,1-2H3/t11?,15-/m0/s1 |
| InChIKey | HZRFRFIYJRTELO-MHTVFEQDSA-N |
| XLogP | 2.55 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|