About 1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium
1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium (PubChem CID 87149918) has the molecular formula C27H23AuOP+
and a molecular weight of 591.42 g/mol. Its IUPAC name is 1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium.
Molecular Properties
| Compound Name | 1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium |
| PubChem CID | 87149918 |
| Molecular Formula | C27H23AuOP+ |
| Molecular Weight | 591.42 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | 1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium |
| SMILES | [Au+].[C-]#Cc1ccc(OC)cc1.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C9H7O.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-8-4-6-9(10-2)7-5-8;/h1-15H;4-7H,2H3;/q;-1;+1/p+1 |
| InChIKey | NTKZBUBMDUKKPR-UHFFFAOYSA-O |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 591.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium?
The IUPAC name of 1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium (CID 87149918) is 1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium.
What is the SMILES notation for 1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium?
The canonical SMILES for 1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium is [Au+].[C-]#Cc1ccc(OC)cc1.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium?
The InChIKey is NTKZBUBMDUKKPR-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H15P.C9H7O.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-8-4-6-9(10-2)7-5-8;/h1-15H;4-7H,2H3;/q;-1;+1/p+1.
What are the key properties of 1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium?
1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium has a molecular weight of 591.42 g/mol, XLogP of 4.81, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynyl-4-methoxybenzene;gold(1+);triphenylphosphanium is sourced from PubChem (CID 87149918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).