About dodec-6-yne-5,8-diol
dodec-6-yne-5,8-diol (PubChem CID 87149921) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is dodec-6-yne-5,8-diol.
Molecular Properties
| Compound Name | dodec-6-yne-5,8-diol |
| PubChem CID | 87149921 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | dodec-6-yne-5,8-diol |
| SMILES | CCCCC(O)C#CC(O)CCCC |
| InChI | InChI=1S/C12H22O2/c1-3-5-7-11(13)9-10-12(14)8-6-4-2/h11-14H,3-8H2,1-2H3 |
| InChIKey | FANPHBQAYIFIQE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dodec-6-yne-5,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodec-6-yne-5,8-diol?
The IUPAC name of dodec-6-yne-5,8-diol (CID 87149921) is dodec-6-yne-5,8-diol.
What is the SMILES notation for dodec-6-yne-5,8-diol?
The canonical SMILES for dodec-6-yne-5,8-diol is CCCCC(O)C#CC(O)CCCC.
What is the InChIKey of dodec-6-yne-5,8-diol?
The InChIKey is FANPHBQAYIFIQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-3-5-7-11(13)9-10-12(14)8-6-4-2/h11-14H,3-8H2,1-2H3.
What are the key properties of dodec-6-yne-5,8-diol?
dodec-6-yne-5,8-diol has a molecular weight of 198.31 g/mol, XLogP of 2.09, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodec-6-yne-5,8-diol is sourced from PubChem (CID 87149921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).