About 2,4-diaminophenol;dihydrochloride
2,4-diaminophenol;dihydrochloride (PubChem CID 8715) has the molecular formula C6H10Cl2N2O
and a molecular weight of 197.07 g/mol. Its IUPAC name is 2,4-diaminophenol;dihydrochloride.
Molecular Properties
| Compound Name | 2,4-diaminophenol;dihydrochloride |
| PubChem CID | 8715 |
| Molecular Formula | C6H10Cl2N2O |
| Molecular Weight | 197.07 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 2,4-diaminophenol;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(O)c(N)c1 |
| InChI | InChI=1S/C6H8N2O.2ClH/c7-4-1-2-6(9)5(8)3-4;;/h1-3,9H,7-8H2;2*1H |
| InChIKey | KQEIJFWAXDQUPR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.07 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diaminophenol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diaminophenol;dihydrochloride?
The IUPAC name of 2,4-diaminophenol;dihydrochloride (CID 8715) is 2,4-diaminophenol;dihydrochloride.
What is the SMILES notation for 2,4-diaminophenol;dihydrochloride?
The canonical SMILES for 2,4-diaminophenol;dihydrochloride is Cl.Cl.Nc1ccc(O)c(N)c1.
What is the InChIKey of 2,4-diaminophenol;dihydrochloride?
The InChIKey is KQEIJFWAXDQUPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O.2ClH/c7-4-1-2-6(9)5(8)3-4;;/h1-3,9H,7-8H2;2*1H.
What are the key properties of 2,4-diaminophenol;dihydrochloride?
2,4-diaminophenol;dihydrochloride has a molecular weight of 197.07 g/mol, XLogP of 1.40, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diaminophenol;dihydrochloride is sourced from PubChem (CID 8715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).