C23H39N5O6S — CID 87150123
tert-butyl N-[(2S)-2-amino-4-methylpentanoyl]-N-[3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]carbamate (PubChem CID 87150123) has the molecular formula C23H39N5O6S and a molecular weight of 513.66 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-amino-4-methylpentanoyl]-N-[3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-amino-4-methylpentanoyl]-N-[3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]carbamate |
|---|---|
| PubChem CID | 87150123 |
| Molecular Formula | C23H39N5O6S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | tert-butyl N-[(2S)-2-amino-4-methylpentanoyl]-N-[3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]carbamate |
| SMILES | CC(C)C[C@H](N)C(=O)N(C(=O)OC(C)(C)C)C(C(=O)C(=O)N/N=C1\SCCN1C)C1CCOCC1 |
| InChI | InChI=1S/C23H39N5O6S/c1-14(2)13-16(24)20(31)28(22(32)34-23(3,4)5)17(15-7-10-33-11-8-15)18(29)19(30)25-26-21-27(6)9-12-35-21/h14-17H,7-13,24H2,1-6H3,(H,25,30)/b26-21-/t16-,17?/m0/s1 |
| InChIKey | MNBWSURZQPUESE-MNIPHPDOSA-N |
| XLogP | 1.55 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|