C20H29ClN4O4S — CID 87150232
2-methylpropyl N-[1-(2,6-dimethylphenyl)-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]carbamate;hydrochloride (PubChem CID 87150232) has the molecular formula C20H29ClN4O4S and a molecular weight of 457.00 g/mol. Its IUPAC name is 2-methylpropyl N-[1-(2,6-dimethylphenyl)-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]carbamate;hydrochloride.
| Compound Name | 2-methylpropyl N-[1-(2,6-dimethylphenyl)-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 87150232 |
| Molecular Formula | C20H29ClN4O4S |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-methylpropyl N-[1-(2,6-dimethylphenyl)-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]carbamate;hydrochloride |
| SMILES | Cc1cccc(C)c1C(NC(=O)OCC(C)C)C(=O)C(=O)N/N=C1\SCCN1C.Cl |
| InChI | InChI=1S/C20H28N4O4S.ClH/c1-12(2)11-28-20(27)21-16(15-13(3)7-6-8-14(15)4)17(25)18(26)22-23-19-24(5)9-10-29-19;/h6-8,12,16H,9-11H2,1-5H3,(H,21,27)(H,22,26);1H/b23-19-; |
| InChIKey | QXGGMBWFEVZRFW-PDEWKSAASA-N |
| XLogP | 2.78 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|