C24H33N5O — CID 87150282
N,N-dimethylaniline;4-N,4-N-dimethylbenzene-1,4-diamine;N,N-dimethyl-4-nitrosoaniline (PubChem CID 87150282) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is N,N-dimethylaniline;4-N,4-N-dimethylbenzene-1,4-diamine;N,N-dimethyl-4-nitrosoaniline.
| Compound Name | N,N-dimethylaniline;4-N,4-N-dimethylbenzene-1,4-diamine;N,N-dimethyl-4-nitrosoaniline |
|---|---|
| PubChem CID | 87150282 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | N,N-dimethylaniline;4-N,4-N-dimethylbenzene-1,4-diamine;N,N-dimethyl-4-nitrosoaniline |
| SMILES | CN(C)c1ccc(N)cc1.CN(C)c1ccc(N=O)cc1.CN(C)c1ccccc1 |
| InChI | InChI=1S/C8H10N2O.C8H12N2.C8H11N/c1-10(2)8-5-3-7(9-11)4-6-8;1-10(2)8-5-3-7(9)4-6-8;1-9(2)8-6-4-3-5-7-8/h3-6H,1-2H3;3-6H,9H2,1-2H3;3-7H,1-2H3 |
| InChIKey | RGNTYXGMXJOYQI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 65.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|