C46H92NO6P — CID 87150903
[(9Z,28Z)-19-[(1S)-1,2-dihydroxyethyl]heptatriaconta-9,28-dien-19-yl] 1-(trimethylazaniumyl)butan-2-yl phosphate (PubChem CID 87150903) has the molecular formula C46H92NO6P and a molecular weight of 786.22 g/mol. Its IUPAC name is [(9Z,28Z)-19-[(1S)-1,2-dihydroxyethyl]heptatriaconta-9,28-dien-19-yl] 1-(trimethylazaniumyl)butan-2-yl phosphate.
| Compound Name | [(9Z,28Z)-19-[(1S)-1,2-dihydroxyethyl]heptatriaconta-9,28-dien-19-yl] 1-(trimethylazaniumyl)butan-2-yl phosphate |
|---|---|
| PubChem CID | 87150903 |
| Molecular Formula | C46H92NO6P |
| Molecular Weight | 786.22 g/mol |
| Exact Mass | 785.67 |
| IUPAC Name | [(9Z,28Z)-19-[(1S)-1,2-dihydroxyethyl]heptatriaconta-9,28-dien-19-yl] 1-(trimethylazaniumyl)butan-2-yl phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(CCCCCCCC/C=C\CCCCCCCC)(OP(=O)([O-])OC(CC)C[N+](C)(C)C)[C@@H](O)CO |
| InChI | InChI=1S/C46H92NO6P/c1-7-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-46(45(49)43-48,53-54(50,51)52-44(9-3)42-47(4,5)6)41-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-8-2/h22-25,44-45,48-49H,7-21,26-43H2,1-6H3/b24-22-,25-23-/t44?,45-/m0/s1 |
| InChIKey | SBNPGAJBCMVELD-IAFGPHJNSA-N |
| XLogP | 12.92 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.22 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|