C12H20N2O8 — CID 87151883
4-[5-(1,4,4,4-tetrahydroxybutyl)pyrazin-2-yl]butane-1,1,1,4-tetrol (PubChem CID 87151883) has the molecular formula C12H20N2O8 and a molecular weight of 320.30 g/mol. Its IUPAC name is 4-[5-(1,4,4,4-tetrahydroxybutyl)pyrazin-2-yl]butane-1,1,1,4-tetrol.
| Compound Name | 4-[5-(1,4,4,4-tetrahydroxybutyl)pyrazin-2-yl]butane-1,1,1,4-tetrol |
|---|---|
| PubChem CID | 87151883 |
| Molecular Formula | C12H20N2O8 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4-[5-(1,4,4,4-tetrahydroxybutyl)pyrazin-2-yl]butane-1,1,1,4-tetrol |
| SMILES | OC(CCC(O)(O)O)c1cnc(C(O)CCC(O)(O)O)cn1 |
| InChI | InChI=1S/C12H20N2O8/c15-9(1-3-11(17,18)19)7-5-14-8(6-13-7)10(16)2-4-12(20,21)22/h5-6,9-10,15-22H,1-4H2 |
| InChIKey | JSWFYUQLYCPNMN-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 187.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|