C21H21F6NO4 — CID 87152267
tert-butyl N-fluoro-N-[[3-[[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-hydroxymethyl]phenyl]methyl]carbamate (PubChem CID 87152267) has the molecular formula C21H21F6NO4 and a molecular weight of 465.39 g/mol. Its IUPAC name is tert-butyl N-fluoro-N-[[3-[[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-hydroxymethyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-fluoro-N-[[3-[[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-hydroxymethyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 87152267 |
| Molecular Formula | C21H21F6NO4 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | tert-butyl N-fluoro-N-[[3-[[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-hydroxymethyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(F)Cc1cccc(C(O)c2cc(F)cc(OC(F)(F)C(F)F)c2)c1 |
| InChI | InChI=1S/C21H21F6NO4/c1-20(2,3)32-19(30)28(27)11-12-5-4-6-13(7-12)17(29)14-8-15(22)10-16(9-14)31-21(25,26)18(23)24/h4-10,17-18,29H,11H2,1-3H3 |
| InChIKey | KGPPZRNPKQAPMR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|