About 1-methyl-2-methylidene-3H-2,1-benzothiazole
1-methyl-2-methylidene-3H-2,1-benzothiazole (PubChem CID 87152524) has the molecular formula C9H11NS
and a molecular weight of 165.26 g/mol. Its IUPAC name is 1-methyl-2-methylidene-3H-2,1-benzothiazole.
Molecular Properties
| Compound Name | 1-methyl-2-methylidene-3H-2,1-benzothiazole |
| PubChem CID | 87152524 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 1-methyl-2-methylidene-3H-2,1-benzothiazole |
| SMILES | C=S1Cc2ccccc2N1C |
| InChI | InChI=1S/C9H11NS/c1-10-9-6-4-3-5-8(9)7-11(10)2/h3-6H,2,7H2,1H3 |
| InChIKey | QKDORAYWULPKTP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-methylidene-3H-2,1-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-methylidene-3H-2,1-benzothiazole?
The IUPAC name of 1-methyl-2-methylidene-3H-2,1-benzothiazole (CID 87152524) is 1-methyl-2-methylidene-3H-2,1-benzothiazole.
What is the SMILES notation for 1-methyl-2-methylidene-3H-2,1-benzothiazole?
The canonical SMILES for 1-methyl-2-methylidene-3H-2,1-benzothiazole is C=S1Cc2ccccc2N1C.
What is the InChIKey of 1-methyl-2-methylidene-3H-2,1-benzothiazole?
The InChIKey is QKDORAYWULPKTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS/c1-10-9-6-4-3-5-8(9)7-11(10)2/h3-6H,2,7H2,1H3.
What are the key properties of 1-methyl-2-methylidene-3H-2,1-benzothiazole?
1-methyl-2-methylidene-3H-2,1-benzothiazole has a molecular weight of 165.26 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-methylidene-3H-2,1-benzothiazole is sourced from PubChem (CID 87152524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).