C9H11NS — CID 87152546
2-methyl-1-methylidene-3H-1,2-benzothiazole (PubChem CID 87152546) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 2-methyl-1-methylidene-3H-1,2-benzothiazole.
| Compound Name | 2-methyl-1-methylidene-3H-1,2-benzothiazole |
|---|---|
| PubChem CID | 87152546 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2-methyl-1-methylidene-3H-1,2-benzothiazole |
| SMILES | C=S1c2ccccc2CN1C |
| InChI | InChI=1S/C9H11NS/c1-10-7-8-5-3-4-6-9(8)11(10)2/h3-6H,2,7H2,1H3 |
| InChIKey | FXOBWGVHJRMXEW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|