C27H36N6O4 — CID 87152553
[(3R,4S)-4-amino-1-(4-aminoperoxyphenyl)pyrrolidin-3-yl]-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]methanone (PubChem CID 87152553) has the molecular formula C27H36N6O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is [(3R,4S)-4-amino-1-(4-aminoperoxyphenyl)pyrrolidin-3-yl]-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]methanone.
| Compound Name | [(3R,4S)-4-amino-1-(4-aminoperoxyphenyl)pyrrolidin-3-yl]-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 87152553 |
| Molecular Formula | C27H36N6O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | [(3R,4S)-4-amino-1-(4-aminoperoxyphenyl)pyrrolidin-3-yl]-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]methanone |
| SMILES | COCCCn1c([C@@H]2CCCN(C(=O)[C@@H]3CN(c4ccc(OON)cc4)C[C@H]3N)C2)nc2ccccc21 |
| InChI | InChI=1S/C27H36N6O4/c1-35-15-5-14-33-25-8-3-2-7-24(25)30-26(33)19-6-4-13-31(16-19)27(34)22-17-32(18-23(22)28)20-9-11-21(12-10-20)36-37-29/h2-3,7-12,19,22-23H,4-6,13-18,28-29H2,1H3/t19-,22-,23-/m1/s1 |
| InChIKey | BGFYLBYNYKTGIX-UEVCKROQSA-N |
| XLogP | 2.43 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|