C12H19ClN2O2 — CID 87152692
2-(2-chloro-4-pyridinyl)-2,2-diethoxy-N-methylethanamine (PubChem CID 87152692) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 2-(2-chloro-4-pyridinyl)-2,2-diethoxy-N-methylethanamine.
| Compound Name | 2-(2-chloro-4-pyridinyl)-2,2-diethoxy-N-methylethanamine |
|---|---|
| PubChem CID | 87152692 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-(2-chloro-4-pyridinyl)-2,2-diethoxy-N-methylethanamine |
| SMILES | CCOC(CNC)(OCC)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C12H19ClN2O2/c1-4-16-12(9-14-3,17-5-2)10-6-7-15-11(13)8-10/h6-8,14H,4-5,9H2,1-3H3 |
| InChIKey | DTQVRLBGECFRFK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|