C8H11F — CID 87152719
(2Z,4E,6E)-4-fluoroocta-2,4,6-triene (PubChem CID 87152719) has the molecular formula C8H11F and a molecular weight of 126.17 g/mol. Its IUPAC name is (2Z,4E,6E)-4-fluoroocta-2,4,6-triene.
| Compound Name | (2Z,4E,6E)-4-fluoroocta-2,4,6-triene |
|---|---|
| PubChem CID | 87152719 |
| Molecular Formula | C8H11F |
| Molecular Weight | 126.17 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (2Z,4E,6E)-4-fluoroocta-2,4,6-triene |
| SMILES | C/C=C\C(F)=C/C=C/C |
| InChI | InChI=1S/C8H11F/c1-3-5-7-8(9)6-4-2/h3-7H,1-2H3/b5-3+,6-4-,8-7+ |
| InChIKey | HCUMGHFBQQFIIY-GOZJPCKMSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|