C11H12F6 — CID 87152760
(3Z,5E)-4-ethyl-7,7,7-trifluoro-6-methyl-2-(trifluoromethyl)hepta-1,3,5-triene (PubChem CID 87152760) has the molecular formula C11H12F6 and a molecular weight of 258.21 g/mol. Its IUPAC name is (3Z,5E)-4-ethyl-7,7,7-trifluoro-6-methyl-2-(trifluoromethyl)hepta-1,3,5-triene.
| Compound Name | (3Z,5E)-4-ethyl-7,7,7-trifluoro-6-methyl-2-(trifluoromethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 87152760 |
| Molecular Formula | C11H12F6 |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (3Z,5E)-4-ethyl-7,7,7-trifluoro-6-methyl-2-(trifluoromethyl)hepta-1,3,5-triene |
| SMILES | C=C(/C=C(\C=C(/C)C(F)(F)F)CC)C(F)(F)F |
| InChI | InChI=1S/C11H12F6/c1-4-9(5-7(2)10(12,13)14)6-8(3)11(15,16)17/h5-6H,2,4H2,1,3H3/b8-6+,9-5- |
| InChIKey | BCRPPFDQRQUNMP-JXCGNHFNSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|