C24H23BN4O4 — CID 87152874
CID 87152874 (PubChem CID 87152874) has the molecular formula C24H23BN4O4 and a molecular weight of 442.28 g/mol.
| Compound Name | CID 87152874 |
|---|---|
| PubChem CID | 87152874 |
| Molecular Formula | C24H23BN4O4 |
| Molecular Weight | 442.28 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(C)O)ccc1Oc1ccc(CNC(=O)C2(NC(=O)c3cncnc3)CC2)cc1 |
| InChI | InChI=1S/C24H23BN4O4/c1-15(30)17-4-7-21(20(25)10-17)33-19-5-2-16(3-6-19)11-28-23(32)24(8-9-24)29-22(31)18-12-26-14-27-13-18/h2-7,10,12-15,30H,8-9,11H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | NXWJBSJBJZQQCE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|