C54H100O12 — CID 87154067
2,3-di(octanoyloxy)propyl octanoate (PubChem CID 87154067) has the molecular formula C54H100O12 and a molecular weight of 941.38 g/mol. Its IUPAC name is 2,3-di(octanoyloxy)propyl octanoate.
| Compound Name | 2,3-di(octanoyloxy)propyl octanoate |
|---|---|
| PubChem CID | 87154067 |
| Molecular Formula | C54H100O12 |
| Molecular Weight | 941.38 g/mol |
| Exact Mass | 940.72 |
| IUPAC Name | 2,3-di(octanoyloxy)propyl octanoate |
| SMILES | CCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCC.CCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCC |
| InChI | InChI=1S/2C27H50O6/c2*1-4-7-10-13-16-19-25(28)31-22-24(33-27(30)21-18-15-12-9-6-3)23-32-26(29)20-17-14-11-8-5-2/h2*24H,4-23H2,1-3H3 |
| InChIKey | OJGYHSAWOHEZDV-UHFFFAOYSA-N |
| XLogP | 14.13 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.38 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|