C10H13N3O — CID 87154170
N'-hydroxy-1,2,3,4-tetrahydroisoquinoline-5-carboximidamide (PubChem CID 87154170) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is N'-hydroxy-1,2,3,4-tetrahydroisoquinoline-5-carboximidamide.
| Compound Name | N'-hydroxy-1,2,3,4-tetrahydroisoquinoline-5-carboximidamide |
|---|---|
| PubChem CID | 87154170 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N'-hydroxy-1,2,3,4-tetrahydroisoquinoline-5-carboximidamide |
| SMILES | N/C(=N\O)c1cccc2c1CCNC2 |
| InChI | InChI=1S/C10H13N3O/c11-10(13-14)9-3-1-2-7-6-12-5-4-8(7)9/h1-3,12,14H,4-6H2,(H2,11,13) |
| InChIKey | MFUJKJZTNGKJNQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|