C8H5F5O2S — CID 87154523
1-ethylsulfonyl-2,3,4,5,6-pentafluorobenzene (PubChem CID 87154523) has the molecular formula C8H5F5O2S and a molecular weight of 260.18 g/mol. Its IUPAC name is 1-ethylsulfonyl-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-ethylsulfonyl-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 87154523 |
| Molecular Formula | C8H5F5O2S |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 1-ethylsulfonyl-2,3,4,5,6-pentafluorobenzene |
| SMILES | CCS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H5F5O2S/c1-2-16(14,15)8-6(12)4(10)3(9)5(11)7(8)13/h2H2,1H3 |
| InChIKey | XBDQVQKPURPKNC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|