C44H20Cl8N4 — CID 87154624
2,3,5,7-tetrakis(2,6-dichlorophenyl)porphyrin (PubChem CID 87154624) has the molecular formula C44H20Cl8N4 and a molecular weight of 888.30 g/mol. Its IUPAC name is 2,3,5,7-tetrakis(2,6-dichlorophenyl)porphyrin.
| Compound Name | 2,3,5,7-tetrakis(2,6-dichlorophenyl)porphyrin |
|---|---|
| PubChem CID | 87154624 |
| Molecular Formula | C44H20Cl8N4 |
| Molecular Weight | 888.30 g/mol |
| Exact Mass | 883.92 |
| IUPAC Name | 2,3,5,7-tetrakis(2,6-dichlorophenyl)porphyrin |
| SMILES | Clc1cccc(Cl)c1C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C(/c6c(Cl)cccc6Cl)C1=N2)C(c1c(Cl)cccc1Cl)=C5c1c(Cl)cccc1Cl)C=C4)C=C3 |
| InChI | InChI=1S/C44H20Cl8N4/c45-27-5-1-6-28(46)36(27)26-19-25-18-23-14-13-21(53-23)17-22-15-16-24(54-22)20-35-40(37-29(47)7-2-8-30(37)48)41(38-31(49)9-3-10-32(38)50)44(56-35)42(43(26)55-25)39-33(51)11-4-12-34(39)52/h1-20H/b21-17-,22-17-,23-18-,24-20-,25-18-,35-20-,43-42-,44-42- |
| InChIKey | IKRNTQWUSIIVAG-YETVPZGYSA-N |
| XLogP | 14.92 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.30 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|