About (2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate
(2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate (PubChem CID 87154944) has the molecular formula C8H12F4O4S
and a molecular weight of 280.24 g/mol. Its IUPAC name is (2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate.
Molecular Properties
| Compound Name | (2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate |
| PubChem CID | 87154944 |
| Molecular Formula | C8H12F4O4S |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | (2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate |
| SMILES | O=S(=O)(OCC(F)(F)F)OC1CCCCC1F |
| InChI | InChI=1S/C8H12F4O4S/c9-6-3-1-2-4-7(6)16-17(13,14)15-5-8(10,11)12/h6-7H,1-5H2 |
| InChIKey | IWCFKHQPBQQWQL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate?
The IUPAC name of (2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate (CID 87154944) is (2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate.
What is the SMILES notation for (2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate?
The canonical SMILES for (2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate is O=S(=O)(OCC(F)(F)F)OC1CCCCC1F.
What is the InChIKey of (2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate?
The InChIKey is IWCFKHQPBQQWQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F4O4S/c9-6-3-1-2-4-7(6)16-17(13,14)15-5-8(10,11)12/h6-7H,1-5H2.
What are the key properties of (2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate?
(2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate has a molecular weight of 280.24 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorocyclohexyl) 2,2,2-trifluoroethyl sulfate is sourced from PubChem (CID 87154944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).