C8H10F8S — CID 87155127
1,1,1,3-tetrafluoro-3-(2,4,4,4-tetrafluorobutan-2-ylsulfanyl)butane (PubChem CID 87155127) has the molecular formula C8H10F8S and a molecular weight of 290.22 g/mol. Its IUPAC name is 1,1,1,3-tetrafluoro-3-(2,4,4,4-tetrafluorobutan-2-ylsulfanyl)butane.
| Compound Name | 1,1,1,3-tetrafluoro-3-(2,4,4,4-tetrafluorobutan-2-ylsulfanyl)butane |
|---|---|
| PubChem CID | 87155127 |
| Molecular Formula | C8H10F8S |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 1,1,1,3-tetrafluoro-3-(2,4,4,4-tetrafluorobutan-2-ylsulfanyl)butane |
| SMILES | CC(F)(CC(F)(F)F)SC(C)(F)CC(F)(F)F |
| InChI | InChI=1S/C8H10F8S/c1-5(9,3-7(11,12)13)17-6(2,10)4-8(14,15)16/h3-4H2,1-2H3 |
| InChIKey | ZGZDHBVJKLWBCS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |