About (2-fluorocyclohexyl) methyl sulfite
(2-fluorocyclohexyl) methyl sulfite (PubChem CID 87155182) has the molecular formula C7H13FO3S
and a molecular weight of 196.24 g/mol. Its IUPAC name is (2-fluorocyclohexyl) methyl sulfite.
Molecular Properties
| Compound Name | (2-fluorocyclohexyl) methyl sulfite |
| PubChem CID | 87155182 |
| Molecular Formula | C7H13FO3S |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | (2-fluorocyclohexyl) methyl sulfite |
| SMILES | COS(=O)OC1CCCCC1F |
| InChI | InChI=1S/C7H13FO3S/c1-10-12(9)11-7-5-3-2-4-6(7)8/h6-7H,2-5H2,1H3 |
| InChIKey | SQZVQTHINUSANG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-fluorocyclohexyl) methyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorocyclohexyl) methyl sulfite?
The IUPAC name of (2-fluorocyclohexyl) methyl sulfite (CID 87155182) is (2-fluorocyclohexyl) methyl sulfite.
What is the SMILES notation for (2-fluorocyclohexyl) methyl sulfite?
The canonical SMILES for (2-fluorocyclohexyl) methyl sulfite is COS(=O)OC1CCCCC1F.
What is the InChIKey of (2-fluorocyclohexyl) methyl sulfite?
The InChIKey is SQZVQTHINUSANG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FO3S/c1-10-12(9)11-7-5-3-2-4-6(7)8/h6-7H,2-5H2,1H3.
What are the key properties of (2-fluorocyclohexyl) methyl sulfite?
(2-fluorocyclohexyl) methyl sulfite has a molecular weight of 196.24 g/mol, XLogP of 1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorocyclohexyl) methyl sulfite is sourced from PubChem (CID 87155182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).