About 3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene
3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene (PubChem CID 87155370) has the molecular formula C7H9F4O3P
and a molecular weight of 248.11 g/mol. Its IUPAC name is 3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene.
Molecular Properties
| Compound Name | 3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene |
| PubChem CID | 87155370 |
| Molecular Formula | C7H9F4O3P |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene |
| SMILES | CP(=O)(OCC=C(F)F)OCC=C(F)F |
| InChI | InChI=1S/C7H9F4O3P/c1-15(12,13-4-2-6(8)9)14-5-3-7(10)11/h2-3H,4-5H2,1H3 |
| InChIKey | VDALAZYHHVFARC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene?
The IUPAC name of 3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene (CID 87155370) is 3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene.
What is the SMILES notation for 3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene?
The canonical SMILES for 3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene is CP(=O)(OCC=C(F)F)OCC=C(F)F.
What is the InChIKey of 3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene?
The InChIKey is VDALAZYHHVFARC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F4O3P/c1-15(12,13-4-2-6(8)9)14-5-3-7(10)11/h2-3H,4-5H2,1H3.
What are the key properties of 3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene?
3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene has a molecular weight of 248.11 g/mol, XLogP of 3.40, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,3-difluoroprop-2-enoxy(methyl)phosphoryl]oxy-1,1-difluoroprop-1-ene is sourced from PubChem (CID 87155370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).