About ethyl (4-fluorocyclohexyl) sulfite
ethyl (4-fluorocyclohexyl) sulfite (PubChem CID 87155399) has the molecular formula C8H15FO3S
and a molecular weight of 210.27 g/mol. Its IUPAC name is ethyl (4-fluorocyclohexyl) sulfite.
Molecular Properties
| Compound Name | ethyl (4-fluorocyclohexyl) sulfite |
| PubChem CID | 87155399 |
| Molecular Formula | C8H15FO3S |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | ethyl (4-fluorocyclohexyl) sulfite |
| SMILES | CCOS(=O)OC1CCC(F)CC1 |
| InChI | InChI=1S/C8H15FO3S/c1-2-11-13(10)12-8-5-3-7(9)4-6-8/h7-8H,2-6H2,1H3 |
| InChIKey | OYGPIGOCLRILTJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (4-fluorocyclohexyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4-fluorocyclohexyl) sulfite?
The IUPAC name of ethyl (4-fluorocyclohexyl) sulfite (CID 87155399) is ethyl (4-fluorocyclohexyl) sulfite.
What is the SMILES notation for ethyl (4-fluorocyclohexyl) sulfite?
The canonical SMILES for ethyl (4-fluorocyclohexyl) sulfite is CCOS(=O)OC1CCC(F)CC1.
What is the InChIKey of ethyl (4-fluorocyclohexyl) sulfite?
The InChIKey is OYGPIGOCLRILTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FO3S/c1-2-11-13(10)12-8-5-3-7(9)4-6-8/h7-8H,2-6H2,1H3.
What are the key properties of ethyl (4-fluorocyclohexyl) sulfite?
ethyl (4-fluorocyclohexyl) sulfite has a molecular weight of 210.27 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4-fluorocyclohexyl) sulfite is sourced from PubChem (CID 87155399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).