C7H9F6O3P — CID 87155499
3-[2,2,2-trifluoroethoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene (PubChem CID 87155499) has the molecular formula C7H9F6O3P and a molecular weight of 286.11 g/mol. Its IUPAC name is 3-[2,2,2-trifluoroethoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene.
| Compound Name | 3-[2,2,2-trifluoroethoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene |
|---|---|
| PubChem CID | 87155499 |
| Molecular Formula | C7H9F6O3P |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 3-[2,2,2-trifluoroethoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene |
| SMILES | C=CCOP(=O)(CC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C7H9F6O3P/c1-2-3-15-17(14,5-7(11,12)13)16-4-6(8,9)10/h2H,1,3-5H2 |
| InChIKey | MNBYNPCHSZFPOL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|