C9H8F4O3S — CID 87155521
(3-fluorophenyl)methyl 2,2,2-trifluoroethyl sulfite (PubChem CID 87155521) has the molecular formula C9H8F4O3S and a molecular weight of 272.22 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 2,2,2-trifluoroethyl sulfite.
| Compound Name | (3-fluorophenyl)methyl 2,2,2-trifluoroethyl sulfite |
|---|---|
| PubChem CID | 87155521 |
| Molecular Formula | C9H8F4O3S |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | (3-fluorophenyl)methyl 2,2,2-trifluoroethyl sulfite |
| SMILES | O=S(OCc1cccc(F)c1)OCC(F)(F)F |
| InChI | InChI=1S/C9H8F4O3S/c10-8-3-1-2-7(4-8)5-15-17(14)16-6-9(11,12)13/h1-4H,5-6H2 |
| InChIKey | OZGZFNLGWPYMBA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |