About 3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene
3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene (PubChem CID 87155765) has the molecular formula C8H12F3O3P
and a molecular weight of 244.15 g/mol. Its IUPAC name is 3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene.
Molecular Properties
| Compound Name | 3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene |
| PubChem CID | 87155765 |
| Molecular Formula | C8H12F3O3P |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene |
| SMILES | C=CCOP(=O)(CC(F)(F)F)OCC=C |
| InChI | InChI=1S/C8H12F3O3P/c1-3-5-13-15(12,14-6-4-2)7-8(9,10)11/h3-4H,1-2,5-7H2 |
| InChIKey | AJGOAKBPTFDIIF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene?
The IUPAC name of 3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene (CID 87155765) is 3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene.
What is the SMILES notation for 3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene?
The canonical SMILES for 3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene is C=CCOP(=O)(CC(F)(F)F)OCC=C.
What is the InChIKey of 3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene?
The InChIKey is AJGOAKBPTFDIIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3O3P/c1-3-5-13-15(12,14-6-4-2)7-8(9,10)11/h3-4H,1-2,5-7H2.
What are the key properties of 3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene?
3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene has a molecular weight of 244.15 g/mol, XLogP of 3.15, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[prop-2-enoxy(2,2,2-trifluoroethyl)phosphoryl]oxyprop-1-ene is sourced from PubChem (CID 87155765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).