C10H2F19O3P — CID 87155870
[2,2,3,3,4,4,5,5,6-nonafluoro-1,6-bis(1,1,2,2,2-pentafluoroethyl)cyclohexyl]phosphonic acid (PubChem CID 87155870) has the molecular formula C10H2F19O3P and a molecular weight of 562.06 g/mol. Its IUPAC name is [2,2,3,3,4,4,5,5,6-nonafluoro-1,6-bis(1,1,2,2,2-pentafluoroethyl)cyclohexyl]phosphonic acid.
| Compound Name | [2,2,3,3,4,4,5,5,6-nonafluoro-1,6-bis(1,1,2,2,2-pentafluoroethyl)cyclohexyl]phosphonic acid |
|---|---|
| PubChem CID | 87155870 |
| Molecular Formula | C10H2F19O3P |
| Molecular Weight | 562.06 g/mol |
| Exact Mass | 561.94 |
| IUPAC Name | [2,2,3,3,4,4,5,5,6-nonafluoro-1,6-bis(1,1,2,2,2-pentafluoroethyl)cyclohexyl]phosphonic acid |
| SMILES | O=P(O)(O)C1(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H2F19O3P/c11-1(4(14,15)9(24,25)26)2(33(30,31)32,6(18,19)10(27,28)29)5(16,17)8(22,23)7(20,21)3(1,12)13/h(H2,30,31,32) |
| InChIKey | HOXGXHXKTHKEJN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.06 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|