About acetyl but-3-ynoate
acetyl but-3-ynoate (PubChem CID 87155884) has the molecular formula C6H6O3
and a molecular weight of 126.11 g/mol. Its IUPAC name is acetyl but-3-ynoate.
Molecular Properties
| Compound Name | acetyl but-3-ynoate |
| PubChem CID | 87155884 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | acetyl but-3-ynoate |
| SMILES | C#CCC(=O)OC(C)=O |
| InChI | InChI=1S/C6H6O3/c1-3-4-6(8)9-5(2)7/h1H,4H2,2H3 |
| InChIKey | PMRWAACERUMPFZ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetyl but-3-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl but-3-ynoate?
The IUPAC name of acetyl but-3-ynoate (CID 87155884) is acetyl but-3-ynoate.
What is the SMILES notation for acetyl but-3-ynoate?
The canonical SMILES for acetyl but-3-ynoate is C#CCC(=O)OC(C)=O.
What is the InChIKey of acetyl but-3-ynoate?
The InChIKey is PMRWAACERUMPFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3/c1-3-4-6(8)9-5(2)7/h1H,4H2,2H3.
What are the key properties of acetyl but-3-ynoate?
acetyl but-3-ynoate has a molecular weight of 126.11 g/mol, XLogP of 0.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl but-3-ynoate is sourced from PubChem (CID 87155884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).