C14H20F3O3P — CID 87155923
3-[cyclohex-2-en-1-yloxy(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexene (PubChem CID 87155923) has the molecular formula C14H20F3O3P and a molecular weight of 324.28 g/mol. Its IUPAC name is 3-[cyclohex-2-en-1-yloxy(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexene.
| Compound Name | 3-[cyclohex-2-en-1-yloxy(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexene |
|---|---|
| PubChem CID | 87155923 |
| Molecular Formula | C14H20F3O3P |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3-[cyclohex-2-en-1-yloxy(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexene |
| SMILES | O=P(CC(F)(F)F)(OC1C=CCCC1)OC1C=CCCC1 |
| InChI | InChI=1S/C14H20F3O3P/c15-14(16,17)11-21(18,19-12-7-3-1-4-8-12)20-13-9-5-2-6-10-13/h3,5,7,9,12-13H,1-2,4,6,8,10-11H2 |
| InChIKey | LLTLUEBCYKAZDX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|