C7H8N2O5 — CID 87156166
1,3-dioxo-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxylic acid (PubChem CID 87156166) has the molecular formula C7H8N2O5 and a molecular weight of 200.15 g/mol. Its IUPAC name is 1,3-dioxo-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxylic acid.
| Compound Name | 1,3-dioxo-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 87156166 |
| Molecular Formula | C7H8N2O5 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1,3-dioxo-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxylic acid |
| SMILES | O=C1OC(=O)N2CCN(C(=O)O)CC12 |
| InChI | InChI=1S/C7H8N2O5/c10-5-4-3-8(6(11)12)1-2-9(4)7(13)14-5/h4H,1-3H2,(H,11,12) |
| InChIKey | VCNZMDWKBTVUIL-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|