About 3-tert-butyl-2,4,4-trimethylpentane-2-thiol
3-tert-butyl-2,4,4-trimethylpentane-2-thiol (PubChem CID 87156736) has the molecular formula C12H26S
and a molecular weight of 202.41 g/mol. Its IUPAC name is 3-tert-butyl-2,4,4-trimethylpentane-2-thiol.
Molecular Properties
| Compound Name | 3-tert-butyl-2,4,4-trimethylpentane-2-thiol |
| PubChem CID | 87156736 |
| Molecular Formula | C12H26S |
| Molecular Weight | 202.41 g/mol |
| Exact Mass | 202.18 |
| IUPAC Name | 3-tert-butyl-2,4,4-trimethylpentane-2-thiol |
| SMILES | CC(C)(C)C(C(C)(C)C)C(C)(C)S |
| InChI | InChI=1S/C12H26S/c1-10(2,3)9(11(4,5)6)12(7,8)13/h9,13H,1-8H3 |
| InChIKey | DCJABCWUQXDYEL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-2,4,4-trimethylpentane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2,4,4-trimethylpentane-2-thiol?
The IUPAC name of 3-tert-butyl-2,4,4-trimethylpentane-2-thiol (CID 87156736) is 3-tert-butyl-2,4,4-trimethylpentane-2-thiol.
What is the SMILES notation for 3-tert-butyl-2,4,4-trimethylpentane-2-thiol?
The canonical SMILES for 3-tert-butyl-2,4,4-trimethylpentane-2-thiol is CC(C)(C)C(C(C)(C)C)C(C)(C)S.
What is the InChIKey of 3-tert-butyl-2,4,4-trimethylpentane-2-thiol?
The InChIKey is DCJABCWUQXDYEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26S/c1-10(2,3)9(11(4,5)6)12(7,8)13/h9,13H,1-8H3.
What are the key properties of 3-tert-butyl-2,4,4-trimethylpentane-2-thiol?
3-tert-butyl-2,4,4-trimethylpentane-2-thiol has a molecular weight of 202.41 g/mol, XLogP of 4.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2,4,4-trimethylpentane-2-thiol is sourced from PubChem (CID 87156736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).