About 5,7-diethylundecan-6-imine
5,7-diethylundecan-6-imine (PubChem CID 87156941) has the molecular formula C15H31N
and a molecular weight of 225.42 g/mol. Its IUPAC name is 5,7-diethylundecan-6-imine.
Molecular Properties
| Compound Name | 5,7-diethylundecan-6-imine |
| PubChem CID | 87156941 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | 5,7-diethylundecan-6-imine |
| SMILES | [H]N=C(C(CC)CCCC)C(CC)CCCC |
| InChI | InChI=1S/C15H31N/c1-5-9-11-13(7-3)15(16)14(8-4)12-10-6-2/h13-14,16H,5-12H2,1-4H3 |
| InChIKey | DCUAAUIRMKPCFP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5,7-diethylundecan-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-diethylundecan-6-imine?
The IUPAC name of 5,7-diethylundecan-6-imine (CID 87156941) is 5,7-diethylundecan-6-imine.
What is the SMILES notation for 5,7-diethylundecan-6-imine?
The canonical SMILES for 5,7-diethylundecan-6-imine is [H]N=C(C(CC)CCCC)C(CC)CCCC.
What is the InChIKey of 5,7-diethylundecan-6-imine?
The InChIKey is DCUAAUIRMKPCFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N/c1-5-9-11-13(7-3)15(16)14(8-4)12-10-6-2/h13-14,16H,5-12H2,1-4H3.
What are the key properties of 5,7-diethylundecan-6-imine?
5,7-diethylundecan-6-imine has a molecular weight of 225.42 g/mol, XLogP of 5.44, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-diethylundecan-6-imine is sourced from PubChem (CID 87156941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).