C13H17ClFN3O3 — CID 87157087
[(3aS,4R,6R,6aR)-4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol (PubChem CID 87157087) has the molecular formula C13H17ClFN3O3 and a molecular weight of 317.75 g/mol. Its IUPAC name is [(3aS,4R,6R,6aR)-4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aS,4R,6R,6aR)-4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 87157087 |
| Molecular Formula | C13H17ClFN3O3 |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | [(3aS,4R,6R,6aR)-4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO)C[C@@H](Nc3nc(Cl)ncc3F)[C@@H]2O1 |
| InChI | InChI=1S/C13H17ClFN3O3/c1-13(2)20-9-6(5-19)3-8(10(9)21-13)17-11-7(15)4-16-12(14)18-11/h4,6,8-10,19H,3,5H2,1-2H3,(H,16,17,18)/t6-,8-,9-,10+/m1/s1 |
| InChIKey | PMASWWRLDJMIHG-QQRDMOCMSA-N |
| XLogP | 1.58 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |