C9H10F4O6S — CID 87157574
1,1,1,2-tetrafluoro-3-oxo-3-(2-oxocyclohexyl)oxypropane-2-sulfonic acid (PubChem CID 87157574) has the molecular formula C9H10F4O6S and a molecular weight of 322.23 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-3-oxo-3-(2-oxocyclohexyl)oxypropane-2-sulfonic acid.
| Compound Name | 1,1,1,2-tetrafluoro-3-oxo-3-(2-oxocyclohexyl)oxypropane-2-sulfonic acid |
|---|---|
| PubChem CID | 87157574 |
| Molecular Formula | C9H10F4O6S |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 1,1,1,2-tetrafluoro-3-oxo-3-(2-oxocyclohexyl)oxypropane-2-sulfonic acid |
| SMILES | O=C1CCCCC1OC(=O)C(F)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C9H10F4O6S/c10-8(9(11,12)13,20(16,17)18)7(15)19-6-4-2-1-3-5(6)14/h6H,1-4H2,(H,16,17,18) |
| InChIKey | GGFWUKLYRBIPNE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|