C13H18F2O7S — CID 87157588
2-[(3,5-dihydroxy-1-adamantyl)methoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 87157588) has the molecular formula C13H18F2O7S and a molecular weight of 356.34 g/mol. Its IUPAC name is 2-[(3,5-dihydroxy-1-adamantyl)methoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[(3,5-dihydroxy-1-adamantyl)methoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 87157588 |
| Molecular Formula | C13H18F2O7S |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[(3,5-dihydroxy-1-adamantyl)methoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(OCC12CC3CC(O)(CC(O)(C3)C1)C2)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C13H18F2O7S/c14-13(15,23(19,20)21)9(16)22-7-10-1-8-2-11(17,4-10)6-12(18,3-8)5-10/h8,17-18H,1-7H2,(H,19,20,21) |
| InChIKey | RGQBQUYEZUQIAP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|