C10H10F6O6S — CID 87157606
2,3,3,4,4,4-hexafluoro-1-oxo-1-(2-oxocyclohexyl)oxybutane-2-sulfonic acid (PubChem CID 87157606) has the molecular formula C10H10F6O6S and a molecular weight of 372.24 g/mol. Its IUPAC name is 2,3,3,4,4,4-hexafluoro-1-oxo-1-(2-oxocyclohexyl)oxybutane-2-sulfonic acid.
| Compound Name | 2,3,3,4,4,4-hexafluoro-1-oxo-1-(2-oxocyclohexyl)oxybutane-2-sulfonic acid |
|---|---|
| PubChem CID | 87157606 |
| Molecular Formula | C10H10F6O6S |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 2,3,3,4,4,4-hexafluoro-1-oxo-1-(2-oxocyclohexyl)oxybutane-2-sulfonic acid |
| SMILES | O=C1CCCCC1OC(=O)C(F)(C(F)(F)C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C10H10F6O6S/c11-8(23(19,20)21,9(12,13)10(14,15)16)7(18)22-6-4-2-1-3-5(6)17/h6H,1-4H2,(H,19,20,21) |
| InChIKey | GTRITZWYIGVCCK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|