About 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate
2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate (PubChem CID 87157951) has the molecular formula C13H21BF4N2O2
and a molecular weight of 324.13 g/mol. Its IUPAC name is 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate.
Molecular Properties
| Compound Name | 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate |
| PubChem CID | 87157951 |
| Molecular Formula | C13H21BF4N2O2 |
| Molecular Weight | 324.13 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate |
| SMILES | C=C(C)C(=O)OCCn1cc[n+](CCCC)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C13H21N2O2.BF4/c1-4-5-6-14-7-8-15(11-14)9-10-17-13(16)12(2)3;2-1(3,4)5/h7-8,11H,2,4-6,9-10H2,1,3H3;/q+1;-1 |
| InChIKey | PRMDXUITHXBNJA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate?
The IUPAC name of 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate (CID 87157951) is 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate.
What is the SMILES notation for 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate?
The canonical SMILES for 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate is C=C(C)C(=O)OCCn1cc[n+](CCCC)c1.F[B-](F)(F)F.
What is the InChIKey of 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate?
The InChIKey is PRMDXUITHXBNJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N2O2.BF4/c1-4-5-6-14-7-8-15(11-14)9-10-17-13(16)12(2)3;2-1(3,4)5/h7-8,11H,2,4-6,9-10H2,1,3H3;/q+1;-1.
What are the key properties of 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate?
2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate has a molecular weight of 324.13 g/mol, XLogP of 2.99, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate tetrafluoroborate is sourced from PubChem (CID 87157951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).