About 5-methyl-3-methylidene-1,3,4-oxathiazole
5-methyl-3-methylidene-1,3,4-oxathiazole (PubChem CID 87158142) has the molecular formula C4H7NOS
and a molecular weight of 117.17 g/mol. Its IUPAC name is 5-methyl-3-methylidene-1,3,4-oxathiazole.
Molecular Properties
| Compound Name | 5-methyl-3-methylidene-1,3,4-oxathiazole |
| PubChem CID | 87158142 |
| Molecular Formula | C4H7NOS |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.02 |
| IUPAC Name | 5-methyl-3-methylidene-1,3,4-oxathiazole |
| SMILES | C=S1COC(C)=N1 |
| InChI | InChI=1S/C4H7NOS/c1-4-5-7(2)3-6-4/h2-3H2,1H3 |
| InChIKey | LTBWKSFFTUGSJV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-methylidene-1,3,4-oxathiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-methylidene-1,3,4-oxathiazole?
The IUPAC name of 5-methyl-3-methylidene-1,3,4-oxathiazole (CID 87158142) is 5-methyl-3-methylidene-1,3,4-oxathiazole.
What is the SMILES notation for 5-methyl-3-methylidene-1,3,4-oxathiazole?
The canonical SMILES for 5-methyl-3-methylidene-1,3,4-oxathiazole is C=S1COC(C)=N1.
What is the InChIKey of 5-methyl-3-methylidene-1,3,4-oxathiazole?
The InChIKey is LTBWKSFFTUGSJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NOS/c1-4-5-7(2)3-6-4/h2-3H2,1H3.
What are the key properties of 5-methyl-3-methylidene-1,3,4-oxathiazole?
5-methyl-3-methylidene-1,3,4-oxathiazole has a molecular weight of 117.17 g/mol, XLogP of 1.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-methylidene-1,3,4-oxathiazole is sourced from PubChem (CID 87158142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).