C22H19Cl3F6N2O — CID 87158235
N-[[4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 87158235) has the molecular formula C22H19Cl3F6N2O and a molecular weight of 547.75 g/mol. Its IUPAC name is N-[[4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | N-[[4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 87158235 |
| Molecular Formula | C22H19Cl3F6N2O |
| Molecular Weight | 547.75 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | N-[[4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | CCC(=O)NCc1ccc(N2CCC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H19Cl3F6N2O/c1-2-18(34)32-10-12-3-4-14(9-15(12)21(26,27)28)33-6-5-20(11-33,22(29,30)31)13-7-16(23)19(25)17(24)8-13/h3-4,7-9H,2,5-6,10-11H2,1H3,(H,32,34) |
| InChIKey | BTCUHYQQWKOUOE-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.75 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|