C21H19Cl4F3N2O — CID 87158378
N-[[2-chloro-4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methyl]propanamide (PubChem CID 87158378) has the molecular formula C21H19Cl4F3N2O and a molecular weight of 514.20 g/mol. Its IUPAC name is N-[[2-chloro-4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methyl]propanamide.
| Compound Name | N-[[2-chloro-4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 87158378 |
| Molecular Formula | C21H19Cl4F3N2O |
| Molecular Weight | 514.20 g/mol |
| Exact Mass | 512.02 |
| IUPAC Name | N-[[2-chloro-4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methyl]propanamide |
| SMILES | CCC(=O)NCc1ccc(N2CCC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1Cl |
| InChI | InChI=1S/C21H19Cl4F3N2O/c1-2-18(31)29-10-12-3-4-14(9-15(12)22)30-6-5-20(11-30,21(26,27)28)13-7-16(23)19(25)17(24)8-13/h3-4,7-9H,2,5-6,10-11H2,1H3,(H,29,31) |
| InChIKey | NLJCTTXKIGJCHM-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.20 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|