C22H18Cl2F8N2O2 — CID 87158425
N-[[4-[3-(3,5-dichloro-2,4-difluorophenyl)-2-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 87158425) has the molecular formula C22H18Cl2F8N2O2 and a molecular weight of 565.29 g/mol. Its IUPAC name is N-[[4-[3-(3,5-dichloro-2,4-difluorophenyl)-2-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | N-[[4-[3-(3,5-dichloro-2,4-difluorophenyl)-2-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 87158425 |
| Molecular Formula | C22H18Cl2F8N2O2 |
| Molecular Weight | 565.29 g/mol |
| Exact Mass | 564.06 |
| IUPAC Name | N-[[4-[3-(3,5-dichloro-2,4-difluorophenyl)-2-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | CCC(=O)NCc1ccc(N2CCC(c3cc(Cl)c(F)c(Cl)c3F)(C(F)(F)F)C2O)cc1C(F)(F)F |
| InChI | InChI=1S/C22H18Cl2F8N2O2/c1-2-15(35)33-9-10-3-4-11(7-12(10)21(27,28)29)34-6-5-20(19(34)36,22(30,31)32)13-8-14(23)18(26)16(24)17(13)25/h3-4,7-8,19,36H,2,5-6,9H2,1H3,(H,33,35) |
| InChIKey | ZVYKNDFNRFVFOU-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.29 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|