C21H20Cl3F3N2O — CID 87158582
N-[1-[4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethyl]acetamide (PubChem CID 87158582) has the molecular formula C21H20Cl3F3N2O and a molecular weight of 479.76 g/mol. Its IUPAC name is N-[1-[4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethyl]acetamide.
| Compound Name | N-[1-[4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 87158582 |
| Molecular Formula | C21H20Cl3F3N2O |
| Molecular Weight | 479.76 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | N-[1-[4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethyl]acetamide |
| SMILES | CC(=O)NC(C)c1ccc(N2CCC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C21H20Cl3F3N2O/c1-12(28-13(2)30)14-3-5-16(6-4-14)29-8-7-20(11-29,21(25,26)27)15-9-17(22)19(24)18(23)10-15/h3-6,9-10,12H,7-8,11H2,1-2H3,(H,28,30) |
| InChIKey | GNEJKIVAQZAVCW-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.76 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|