C19H16F2N8O2 — CID 87158734
6-[5-[6-(2,2-difluoroethoxy)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-2-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 87158734) has the molecular formula C19H16F2N8O2 and a molecular weight of 426.39 g/mol. Its IUPAC name is 6-[5-[6-(2,2-difluoroethoxy)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-2-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[5-[6-(2,2-difluoroethoxy)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-2-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 87158734 |
| Molecular Formula | C19H16F2N8O2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 6-[5-[6-(2,2-difluoroethoxy)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-2-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(c1ccccc1)c1nc(N)nc(-c2noc(-c3ccc(OCC(F)F)nc3)n2)n1 |
| InChI | InChI=1S/C19H16F2N8O2/c1-29(12-5-3-2-4-6-12)19-26-15(25-18(22)27-19)16-24-17(31-28-16)11-7-8-14(23-9-11)30-10-13(20)21/h2-9,13H,10H2,1H3,(H2,22,25,26,27) |
| InChIKey | DBJGSVUHCUFBEY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |