C14H18F10 — CID 87159133
9,10,10,10-tetrafluoro-9-(trifluoromethyl)-4-(3,3,3-trifluoropropyl)dec-1-ene (PubChem CID 87159133) has the molecular formula C14H18F10 and a molecular weight of 376.28 g/mol. Its IUPAC name is 9,10,10,10-tetrafluoro-9-(trifluoromethyl)-4-(3,3,3-trifluoropropyl)dec-1-ene.
| Compound Name | 9,10,10,10-tetrafluoro-9-(trifluoromethyl)-4-(3,3,3-trifluoropropyl)dec-1-ene |
|---|---|
| PubChem CID | 87159133 |
| Molecular Formula | C14H18F10 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 9,10,10,10-tetrafluoro-9-(trifluoromethyl)-4-(3,3,3-trifluoropropyl)dec-1-ene |
| SMILES | C=CCC(CCCCC(F)(C(F)(F)F)C(F)(F)F)CCC(F)(F)F |
| InChI | InChI=1S/C14H18F10/c1-2-5-10(7-9-12(16,17)18)6-3-4-8-11(15,13(19,20)21)14(22,23)24/h2,10H,1,3-9H2 |
| InChIKey | SWXBPYXGTKPKIX-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|