C10H12F8S — CID 87159196
1-fluoro-2-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]hex-5-ene-1-thiol (PubChem CID 87159196) has the molecular formula C10H12F8S and a molecular weight of 316.26 g/mol. Its IUPAC name is 1-fluoro-2-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]hex-5-ene-1-thiol.
| Compound Name | 1-fluoro-2-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]hex-5-ene-1-thiol |
|---|---|
| PubChem CID | 87159196 |
| Molecular Formula | C10H12F8S |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 1-fluoro-2-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]hex-5-ene-1-thiol |
| SMILES | C=CCCC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)S |
| InChI | InChI=1S/C10H12F8S/c1-2-3-4-6(7(11)19)5-8(12,9(13,14)15)10(16,17)18/h2,6-7,19H,1,3-5H2 |
| InChIKey | OGOJVAFHDQYORI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|